A1425312
Boc-Dap(Fmoc)-OH , ≥98.0%(HPLC) , 122235-70-5
Synonym(s):
Nα-Boc-Nβ-Fmoc-L -2,3-diaminopropionic acid;Boc-3-(Fmoc-amino)-L -alanine
CAS NO.：122235-70-5
Empirical Formula: C23H26N2O6
Molecular Weight: 426.46
MDL number: MFCD00235897
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB62.40 | In Stock |
|
| 5G | RMB249.60 | In Stock |
|
| 25g | RMB900.00 | In Stock |
|
| 100g | RMB2856.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-89° (dec.) |
| Boiling point: | 652.5±55.0 °C(Predicted) |
| Density | 1.263±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in 2ml dimethyl formamide 0.3gram. |
| pka | 3?+-.0.10(Predicted) |
| form | solid |
| Appearance | White to off-white Solid |
| optical activity | Consistent with structure |
| BRN | 4771385 |
| InChIKey | MVWPBNQGEGBGRF-IBGZPJMESA-N |
| SMILES | C(O)(=O)[C@H](CNC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)NC(OC(C)(C)C)=O |
Description and Uses
It has been used in the synthesis of target chelator, the tris-catechol compound 2.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
