A3239012
Diethyl acetamidomalonate , 98% , 1068-90-2
Synonym(s):
Acetamidomalonic acid diethyl ester
CAS NO.:1068-90-2
Empirical Formula: C9H15NO5
Molecular Weight: 217.22
MDL number: MFCD00009146
EINECS: 213-952-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB31.20 | In Stock |
|
| 100G | RMB74.40 | In Stock |
|
| 500G | RMB271.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-98 °C (lit.) |
| Boiling point: | 185 °C/20 mmHg (lit.) |
| Density | 1.2850 (rough estimate) |
| refractive index | 1.4640 (estimate) |
| Flash point: | 185°C/20mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 11.93±0.59(Predicted) |
| form | Crystalline Powder |
| color | White to light yellow |
| Water Solubility | Soluble in chloroform and methanol. Slightly soluble in water. |
| BRN | 783883 |
| InChI | 1S/C9H15NO5/c1-4-14-8(12)7(10-6(3)11)9(13)15-5-2/h7H,4-5H2,1-3H3,(H,10,11) |
| InChIKey | ISOLMABRZPQKOV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(NC(C)=O)C(=O)OCC |
| CAS DataBase Reference | 1068-90-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Propanedioic acid, (acetylamino)-, diethyl ester(1068-90-2) |
| EPA Substance Registry System | Propanedioic acid, 2-(acetylamino)-, 1,3-diethyl ester (1068-90-2) |
Description and Uses
Diethyl acetamidomalonate is a versatile building block used for the synthesis of various pharmaceutical and biologically active compounds. It is an intermediate for the preparation of Novobiocin analogues as potential heat shock protein 90 inhibitors. It is also used as a important intermediates in syntheses of vitamins B1 and B6, barbiturates, non-steroidal anti-inflammatory agents, other numerous pharmaceuticals.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H290 |
| Precautionary statements | P501-P234-P264-P280-P390-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P406-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36-36/37/38 |
| Safety Statements | 39-36-26-44 |
| WGK Germany | 3 |
| RTECS | OO0360000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29241900 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 1068-90-2(Hazardous Substances Data) |
| Toxicity | eye-rbt 500 mg/24H MLD 28ZPAK -,130,72 |






