A3240612
2-Deoxy-L-ribose , 98% , 18546-37-7
Synonym(s):
2-Deoxy-L -erythro-pentose
CAS NO.：18546-37-7
Empirical Formula: C5H10O4
Molecular Weight: 134.13
MDL number: MFCD00132941
EINECS: 606-054-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB26.40 | In Stock |
|
| 1G | RMB63.20 | In Stock |
|
| 5G | RMB255.20 | In Stock |
|
| 25g | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-72°C |
| alpha | 57 º (c=0.9 H2O after 24h) |
| Boiling point: | 167.23°C (rough estimate) |
| Density | 1.0590 (rough estimate) |
| refractive index | 1.4050 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| pka | 13.58±0.20(Predicted) |
| form | Solid |
| color | Light Yellow to Pale Beige |
| optical activity | [α]/D 54.0±2.0°, 24 hr, c = 1 in H2O |
| InChI | InChI=1S/C5H10O4/c6-2-1-4(8)5(9)3-7/h2,4-5,7-9H,1,3H2/t4-,5+/m1/s1 |
| InChIKey | ASJSAQIRZKANQN-UHNVWZDZSA-N |
| SMILES | O=CC[C@H]([C@H](CO)O)O |
| CAS DataBase Reference | 18546-37-7(CAS DataBase Reference) |
Description and Uses
2-Deoxy-L-ribose is an isomer of 2-Deoxy-D-ribose (D252000) which induces apoptosis by inhibiting the synthesis and increasing the efflux of glutathione.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-37/39-36-26 |
| HS Code | 29329990 |
