A7113512
D-(-)-Ribose , Used for cell culture, ≥99%(HPLC) , 50-69-1
Synonym(s):
D -Ribofuranose
CAS NO.:50-69-1
Empirical Formula: C5H10O5
Molecular Weight: 150.13
MDL number: MFCD00135453
EINECS: 200-059-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB96.00 | In Stock |
|
| 100G | RMB270.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-92 °C(lit.) |
| alpha | -20.8 º (c=4, H2O) |
| Boiling point: | 191.65°C (rough estimate) |
| Density | 1.1897 (rough estimate) |
| bulk density | 480kg/m3 |
| refractive index | -21 ° (C=1, H2O) |
| FEMA | 3793 | D-RIBOSE |
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 g/mL, clear, colorless to light yellow |
| pka | 12.46±0.20(Predicted) |
| form | Crystalline Powder |
| color | White to light beige or slightly yellow |
| PH Range | 7 |
| PH | 7 (20°C, 10g/L in H2O) |
| biological source | microbial (fermentation) |
| optical activity | [α]21/D 19.7°, c = 4 in H2O |
| Water Solubility | Soluble in water. Insoluble in ether. |
| Sensitive | Hygroscopic |
| Merck | 14,8204 |
| BRN | 1723081 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | SKIN CONDITIONING HUMECTANT |
| InChI | 1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4+,5-/m0/s1 |
| InChIKey | HMFHBZSHGGEWLO-SOOFDHNKSA-N |
| SMILES | OC[C@@H](O)[C@@H](O)[C@@H](O)C([H])=O |
| LogP | -1.47 |
| CAS DataBase Reference | 50-69-1(CAS DataBase Reference) |
| NIST Chemistry Reference | D-Ribose(50-69-1) |
| EPA Substance Registry System | D-Ribose (50-69-1) |
| CAS Number Unlabeled | 50-69-1 |
Description and Uses
D-ribose is an important five-carbon monosaccharide with the chemical formula C5H10O5. It is an important constituent of ribonucleic acid (RNA) and ATP, and plays an important role in the formation of life. It is also an important pharmaceutical intermediate for the production of various nucleic acid drugs.
D-Ribose is produced by microorganism fermentation of glucose in a fermentation culture medium without adding calcium carbonate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 24/25-37/39-26 |
| WGK Germany | 3 |
| RTECS | VJ2275000 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |





