A7116312
L-(+)-Ribose , 98% , 24259-59-4
Synonym(s):
D -(−)-Ribose
CAS NO.：24259-59-4
Empirical Formula: C5H10O5
Molecular Weight: 150.13
MDL number: MFCD00167010
EINECS: 246-110-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB62.40 | In Stock |
|
| 10g | RMB133.60 | In Stock |
|
| 25G | RMB200.80 | In Stock |
|
| 100G | RMB668.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-82 °C(lit.) |
| alpha | 20 º (c=2,water) |
| Boiling point: | 191.65°C (rough estimate) |
| Density | 1.1897 (rough estimate) |
| refractive index | 20 ° (C=1, H2O) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| pka | 12.22(at 25℃) |
| color | White to Off-White |
| Water Solubility | Soluble in water (100 mg/ml). |
| BRN | 1723084 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4+,5-/m1/s1 |
| InChIKey | PYMYPHUHKUWMLA-MROZADKFSA-N |
| SMILES | O=C[C@H]([C@H]([C@H](CO)O)O)O |
| CAS DataBase Reference | 24259-59-4(CAS DataBase Reference) |
Description and Uses
It is produced by microorganism fermentation of glucose in a fermentation culture medium without adding calcium carbonate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-37-36-36/38 |
| Safety Statements | 24/25-36-26-37/39 |
| WGK Germany | 3 |
| RTECS | 246-110-4 |
| F | 3-10 |
| HS Code | 29400000 |
