BD9111031
L-Arabinopyranose , 98% , 87-72-9
Synonym(s):
L(+)-Arabinose;Pectin sugar;Pectinose
CAS NO.:87-72-9
Empirical Formula: C5H10O5
Molecular Weight: 150.13
MDL number: MFCD00006609
EINECS: 201-767-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB31.20 | In Stock |
|
| 25g | RMB61.60 | In Stock |
|
| 100g | RMB104.00 | In Stock |
|
| 500g | RMB316.00 | In Stock |
|
| 1000g | RMB568.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-163 °C(lit.) |
| alpha | 103 º (c=5, H2O) |
| Boiling point: | 191.65°C (rough estimate) |
| Density | 1.1897 (rough estimate) |
| refractive index | 1.3920 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Methanol (Slightly), Water (Sparingly) |
| pka | 12.26±0.70(Predicted) |
| form | Fine Crystalline Powder |
| color | White |
| optical activity | +190.6 → +104.5 |
| Water Solubility | soluble |
| Merck | 14,761 |
| BRN | 1723085 |
| InChI | 1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5/m1/s1 |
| InChIKey | SRBFZHDQGSBBOR-ZRMNMSDTSA-N |
| SMILES | O1C([C@H]([C@@H]([C@@H](C1)O)O)O)O |
| CAS DataBase Reference | 87-72-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Arabinose(L)(87-72-9) |
| EPA Substance Registry System | L-Arabinopyranose (87-72-9) |
Description and Uses
L-(+)-Arabinose is used to identify and differentiate and characterize pentose sugar isomerase. It is also used as the carbon source in microbial culture. It is involved in the bioproduction of L-ribose. It finds application in the production of savory reaction flavors. Its derivatives are used in the development of antiviral agents such as nucleoside. It acts as a base component of hemicellulose and pectin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29400000 |
| Storage Class | 11 - Combustible Solids |





