PRODUCT Properties
| Melting point: | 158-160 °C |
| alpha | D12 +173° (6 min) D20 +105.1° (22 hrs c = 3) |
| Boiling point: | 415.5±38.0 °C(Predicted) |
| Density | 1.609 g/cm3(Temp: -5 °C) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Methanol (Slightly, Heated, Sonicated), Water (Slightly) |
| form | Solid |
| pka | 12.46±0.20(Predicted) |
| color | White to Off-White |
| Water Solubility | soluble |
| Merck | 14,761 |
| BRN | 1723086 |
| InChI | 1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4-,5+/m0/s1 |
| InChIKey | PYMYPHUHKUWMLA-VAYJURFESA-N |
| SMILES | OC[C@H](O)[C@H](O)[C@@H](O)C=O |
| LogP | -2.812 (est) |
| CAS DataBase Reference | 147-81-9(CAS DataBase Reference) |
| EPA Substance Registry System | Arabinose (147-81-9) |
Description and Uses
DL-Arabinose is used in physicochemical studies to measure properties such as dielectric relaxation. It may be used in chiral separation of sugars. DL-Arabinose, is a building block of polysaccharide (CCPa-1) from fungus Coprinus comatus Gray, which has potential application as natural antitumor agent with immunomodulatory activity. Arabinose is also used as a culture medium for certain bacteria.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2940.00.6000 |
| Storage Class | 11 - Combustible Solids |





