A0712412
L-(-)-Arabitol , 99% , 7643-75-6
Synonym(s):
L -(−)-Arabitol;L -Arabinitol
CAS NO.:7643-75-6
Empirical Formula: C5H12O5
Molecular Weight: 152.15
MDL number: MFCD00064290
EINECS: 231-582-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB132.80 | In Stock |
|
| 25G | RMB445.60 | In Stock |
|
| 100G | RMB1796.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-104 °C(lit.) |
| Boiling point: | 194.6°C (rough estimate) |
| Density | 1.1497 (rough estimate) |
| refractive index | 1.3960 (estimate) |
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| form | Powder |
| pka | 13.24±0.20(Predicted) |
| color | White to off-white |
| Water Solubility | Soluble in water (50 mg/ml). |
| Sensitive | Hygroscopic |
| Merck | 14,762 |
| BRN | 1720521 |
| Henry's Law Constant | 8.9×1018 mol/(m3Pa) at 25℃, Saxena and Hildemann (1996) |
| Stability: | Hygroscopic |
| InChI | 1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | HEBKCHPVOIAQTA-IMJSIDKUSA-N |
| SMILES | OC[C@H](O)C(O)[C@@H](O)CO |
| LogP | -2.649 (est) |
| CAS DataBase Reference | 7643-75-6(CAS DataBase Reference) |
| EPA Substance Registry System | L-Arabinitol (7643-75-6) |
Description and Uses
L-Arabitol, a rare sugar alcohol, is being studied as a food additive that reduces fat deposits in the intestines. L-Arabitol is used as an inducer of xylanase expression in Hypocrea jecorina (Trichoderma reesei). L-Arabitol is used to identify, differentiate and characterize L-arabitol dehydrogenase(s).
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29054990 |
| Storage Class | 11 - Combustible Solids |




