A3248212
3′-Deoxythymidine , 98% , 3416-05-5
Synonym(s):
2′,3′-Dideoxythymidine;DDT
CAS NO.:3416-05-5
Empirical Formula: C10H14N2O4
Molecular Weight: 226.23
MDL number: MFCD00010570
EINECS: 2017-001-1
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB141.60 | In Stock |
|
| 100MG | RMB445.60 | In Stock |
|
| 500MG | RMB1600.00 | In Stock |
|
| 1g | RMB1980.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-156 °C(lit.) |
| alpha | 20 º (C=0.6 IN H2O) |
| Density | 1.332±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMF: 25 mg/ml,DMF:PBS (pH 7.2) (1:5): 0.16 mg/ml,DMSO: 20 mg/ml |
| pka | 9.55±0.10(Predicted) |
| form | Powder |
| color | White to Pale Yellow |
| optical activity | [α]19/D +20.0°, c = 0.6 in H2O |
| BRN | 21884 |
| InChI | InChI=1S/C10H14N2O4/c1-6-4-12(10(15)11-9(6)14)8-3-2-7(5-13)16-8/h4,7-8,13H,2-3,5H2,1H3,(H,11,14,15)/t7-,8+/m0/s1 |
| InChIKey | XKKCQTLDIPIRQD-JGVFFNPUSA-N |
| SMILES | O=C1NC(C(=CN1[C@H]1CC[C@H](O1)CO)C)=O |
| CAS DataBase Reference | 3416-05-5(CAS DataBase Reference) |
Description and Uses
3’-Deoxythymidine inhibits the ability of bacteriophage T7 to infect Escherichia coli by inhibiting phage DNA synthesis. Also, it is a precursor of DNA polymerase β inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |





