A6951758
2′,3′-Dideoxyadenosine , 10mMinDMSO , 4097-22-7
Synonym(s):
2′,3′-Dideoxyadenosine;ddA
CAS NO.:4097-22-7
Empirical Formula: C10H13N5O2
Molecular Weight: 235.24
MDL number: MFCD00010534
EINECS: 223-853-2
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181-184 °C(lit.) |
| alpha | D25 -25.2° (c = 1.01 in water) |
| Boiling point: | 377.64°C (rough estimate) |
| Density | 1.2455 (rough estimate) |
| refractive index | -34 ° (C=1, H2O) |
| storage temp. | -20°C |
| solubility | DMF: 1 mg/mL; DMSO: 2 mg/mL; Ethanol: Slightly soluble |
| pka | pKa 3.84(H2O t=25.0±0. I=0.01) (Uncertain) |
| form | Powder |
| color | White to Off-white |
| optical activity | [α]/D -28.0±1.0 |
| Water Solubility | 43.2g/L(25 ºC) |
| Merck | 14,3101 |
| BRN | 619924 |
| InChI | 1S/C10H13N5O2/c11-9-8-10(13-4-12-9)15(5-14-8)7-2-1-6(3-16)17-7/h4-7,16H,1-3H2,(H2,11,12,13)/t6-,7+/m0/s1 |
| InChIKey | WVXRAFOPTSTNLL-NKWVEPMBSA-N |
| SMILES | Nc1ncnc2n(cnc12)[C@H]3CC[C@@H](CO)O3 |
| CAS DataBase Reference | 4097-22-7(CAS DataBase Reference) |
| EPA Substance Registry System | Adenosine, 2',3'-dideoxy- (4097-22-7) |
Description and Uses
Dideoxy Adenosine (Didanosine EP Impurity G) is a potent anti-HIV agent.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H341-H303 |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | C |
| Risk Statements | 34-36/37-22 |
| Safety Statements | 26-27-36/37/39-45-24/25 |
| WGK Germany | 2 |
| RTECS | AU7358900 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 oral in mouse: 5gm/kg |






