PRODUCT Properties
| Melting point: | 187-189 °C | 
                                    
| Boiling point: | 394.4°C (rough estimate) | 
                                    
| Density | 1.2938 (rough estimate) | 
                                    
| refractive index | 1.7610 (estimate) | 
                                    
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C | 
                                    
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | 
                                    
| form | powder | 
                                    
| pka | pK1:3.8(+1) (25°C,μ=0.1) | 
                                    
| color | White | 
                                    
| PH | 3.8 | 
                                    
| Water Solubility | Soluble in water and caustic soda. | 
                                    
| λmax | 258 (pH 2);260 (pH 7) | 
                                    
| Stability: | Hygroscopic | 
                                    
| InChI | InChI=1S/C10H13N5O3/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(17)6(2-16)18-7/h3-7,16-17H,1-2H2,(H2,11,12,13)/t5-,6+,7+/m0/s1 | 
                                    
| InChIKey | OLXZPDWKRNYJJZ-RRKCRQDMSA-N | 
                                    
| SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N)N=C2)C[C@@H]1O | 
                                    
| CAS DataBase Reference | 958-09-8(CAS DataBase Reference) | 
                                    
| NIST Chemistry Reference | Deoxyadenosine(958-09-8) | 
                                    
| EPA Substance Registry System | Adenosine, 2'-deoxy- (958-09-8) | 
                                    
Description and Uses
2'-Deoxyadenosine is a natural deoxyribonucleoside, which is a structural fragment of deoxyribonucleic acid DNA. It is a purine nucleoside component of DNA comprised of adenosine linked by its N9 nitrogen to the C1 carbon of deoxyribose. Like other natural nucleosides, it is involved in the transmission of genetic information in almost all biological cells, affecting protein synthesis and polysaccharide. It plays a very important role in regulating the growth, proliferation, differentiation and inhibition of cells in vivo.
2'-Deoxyadenosine is used in paradoxical stimulation study of human sperm motility. It plays an essential role as sperm motility stimulants used in sperm micro-injection on mouse and human embryo development. It finds an application in some cells as an energy source under energy stress conditions. It is involved in various biological processes to compare the functions of adenosine analogues.
Safety
| Symbol(GHS) | ![]() GHS06  | 
                                    
| Signal word | Danger | 
| Hazard statements | H301 | 
| Precautionary statements | P264-P270-P301+P310 | 
| RIDADR | 2811 | 
| WGK Germany | 3 | 
| RTECS | AU7358600 | 
| F | 10-23 | 
| TSCA | Yes | 
| HazardClass | 6.1 | 
| PackingGroup | Ⅲ | 
| HS Code | 2934999090 | 





