PRODUCT Properties
| Melting point: | 127-129 °C(lit.) |
| alpha | 34 º (C=0.4 IN H2O) |
| Density | 1.397±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMF: 10 mg/ml; DMSO: 10 mg/ml; Ethanol: Slightly soluble; PBS (pH 7.2): 5 mg/ml |
| form | A solid |
| pka | 9.39±0.10(Predicted) |
| color | White to off-white |
| optical activity | [α]20/D +34°, c = 0.4 in H2O |
| BRN | 750592 |
| InChI | InChI=1S/C9H12N2O4/c12-5-6-1-2-8(15-6)11-4-3-7(13)10-9(11)14/h3-4,6,8,12H,1-2,5H2,(H,10,13,14)/t6-,8+/m0/s1 |
| InChIKey | BTOTXLJHDSNXMW-POYBYMJQSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C=CC(=O)NC2=O)CC1 |
| CAS DataBase Reference | 5983-09-5(CAS DataBase Reference) |
Description and Uses
Research tool for antiviral and anticancer studies.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 22-24/25-45-36/37/39-27-26 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |






