2'-Deoxyuridine , 10mMinDMSO , 951-78-0
Synonym(s):
1-(2-Deoxy-β-D -ribofuranosyl)uracil;Uracil deoxyriboside
CAS NO.:951-78-0
Empirical Formula: C9H12N2O5
Molecular Weight: 228.2
MDL number: MFCD00006527
EINECS: 213-455-7
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 167-169 °C(lit.) |
| alpha | D22 +50° (c = 1.1 in N NaOH) |
| Boiling point: | 370.01°C (rough estimate) |
| Density | 1.3705 (rough estimate) |
| refractive index | 52 ° (C=1, 1mol/L NaOH) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated), Water (Slightly) |
| form | Powder |
| pka | pKa 9.3(H2O
t = 25) (Uncertain) |
| color | White to off-white |
| biological source | synthetic (organic) |
| Water Solubility | 300 g/L (20 ºC) |
| Sensitive | Air Sensitive |
| Merck | 14,2910 |
| BRN | 24433 |
| InChI | 1S/C9H12N2O5/c12-4-6-5(13)3-8(16-6)11-2-1-7(14)10-9(11)15/h1-2,5-6,8,12-13H,3-4H2,(H,10,14,15)/t5-,6+,8+/m0/s1 |
| InChIKey | MXHRCPNRJAMMIM-ATRFCDNQSA-N |
| SMILES | OC[C@H]1O[C@H](C[C@@H]1O)N2C=CC(=O)NC2=O |
| CAS DataBase Reference | 951-78-0(CAS DataBase Reference) |
| EPA Substance Registry System | Uridine, 2'-deoxy- (951-78-0) |
Description and Uses
2'-Deoxyuridine is an intermediate in the synthesis of thymidylate, which is a precursor for DNA synthesis. It has been shown to inhibit the enzymatic activity of enzymes responsible for synthesizing uridine and thymidylate, leading to neuronal death. 2'-Deoxyuridine has been used as a fluorescence probe for nucleic acids and as a polymerase chain reaction (PCR) substrate. It is also known to bind with toll-like receptor 4 (TLR4), which is involved in inflammatory responses.
2'-Deoxyuridine is frequently halogenated to create thymidine analogues useful for studies of DNA synthesis and degradation mechanisms. Derivatized 2'-Deoxyuridines used as labeling substrates include chloro-2'-deoxyuridine (CldU), bromodeoxyuridine (BrdU) and/or iododeoxyuridine (IdU). Other useful analogues of 2'-deoxyuridine include 5-ethynyl-2'-deoxyuridine (DdU) and 5-hydroxymethyl-2'-deoxyuridine (HmdU). Laboratory suppression of deoxyuridine is used to diagnose megaloblastic anemias due to vitamin B12 and folate deficiencies. Deoxyuridine (dU) is used to indirectly determine if there are sufficient levels of folate and cobalamin in cell or tissue samples.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-36/37/39-26 |
| WGK Germany | 3 |
| RTECS | YU7490000 |
| F | 10-23 |
| Hazard Note | Air Sensitive |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |






