A3248412
Di-tert-butylsilyl bis(trifluoromethanesulfonate) , 97% , 85272-31-7
Synonym(s):
Di-tert-butylsilyl ditriflate;DTBS ditriflate;Trifluoromethanesulfonic acid di-tert-butylsilylene ester
CAS NO.:85272-31-7
Empirical Formula: C10H18F6O6S2Si
Molecular Weight: 440.45
MDL number: MFCD00010581
EINECS: 680-172-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB73.60 | In Stock |
|
| 5G | RMB292.80 | In Stock |
|
| 25G | RMB1372.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 73-75 °C/0.35 mmHg (lit.) |
| Density | 1.352 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 195 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | sol most common organic solvents. |
| form | Oil |
| color | Clear Pale Yellow |
| Specific Gravity | 1.358 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 3569211 |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C10H18F6O6S2Si/c1-7(2,3)25(8(4,5)6,21-23(17,18)9(11,12)13)22-24(19,20)10(14,15)16/h1-6H3 |
| InChIKey | HUHKPYLEVGCJTG-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)S(O[Si](C(C)(C)C)(C(C)(C)C)OS(C(F)(F)F)(=O)=O)(=O)=O |
| CAS DataBase Reference | 85272-31-7(CAS DataBase Reference) |
Description and Uses
Protecting group reagent for 1,3-diols used recently in a synthesis of N-homoceramides. Also used for selective α-galactosylation in the synthesis of α-galactosyl ceramides.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Corrosive |
| TSCA | No |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





