T8709330
Di-tert-Butylsilane , >95.0%(GC) , 30736-07-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB312.00 | In Stock |
|
| 5g | RMB1080.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -38 °C (lit.) |
| Boiling point: | 129-130 °C (lit.) |
| Density | 0.729 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 28 °F |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.74 |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| InChI | 1S/C8H20Si/c1-7(2,3)9-8(4,5)6/h9H2,1-6H3 |
| InChIKey | ZLKSBZCITVUTSN-UHFFFAOYSA-N |
| SMILES | [H][Si]([H])(C(C)(C)C)C(C)(C)C |
| CAS DataBase Reference | 30736-07-3(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, bis(1,1-dimethylethyl)- (30736-07-3) |
Description and Uses
Di-tert-butylsilane can be used as a reagent to synthesize:
- 1,1-di-tert-butyl-N-phenylsilanamine by dehydrogenative coupling with aniline in the presence of supported gold catalyst.
- Benzyloxy di-tert-butylsilane by dehydrocoupling of benzyl alcohol using NaOH as a catalyst.
- Di-tert-butyl(3-cyclohexylprop-1-yn-1-yl)silane by silylation reaction with 2-propyn-1-ylcyclohexane using alkali metal hydroxide as a catalyst.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Danger |
| Hazard statements | H225 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 16-33 |
| RIDADR | UN 1993 3/PG 1 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2931.90.9010 |
| HazardClass | 3 |
| PackingGroup | II |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
