S450678
Di-tert-butylchlorosilane , 97% , 56310-18-0
Synonym(s):
Chloro-di-tert-butylsilane
| Pack Size | Price | Stock | Quantity |
| 10g | RMB1173.56 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 82-84 °C/45 mmHg (lit.) |
| Density | 0.884 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 103 °F |
| form | Liquid |
| color | Clear colorless |
| Specific Gravity | 0.884 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 2203045 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C8H19ClSi/c1-7(2,3)10(9)8(4,5)6/h10H,1-6H3 |
| InChIKey | OGWXFZNXPZTBST-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[SiH](Cl)C(C)(C)C |
| CAS DataBase Reference | 56310-18-0 |
Description and Uses
Considerable study of
alkoxysilanes as intramolecular hydrogen transfer agents has
been undertaken.The di-t-butyloxysilanes, prepared from di-tbutylchlorosilane
and the requisite alcohol, are particularly effective
and are generally stable to column chromatography.
Treatment of a γ-iodoallylic alcohol with NaH and t-Bu2SiHCl
afforded the corresponding di-t-butyloxysilanes which were exposed
to UV irradiation in the presence of 10% hexabutylditin
in the so-called unimolecular chain transfer (UMCT) reaction of
silicon hydrides to afford the reduced alkene (eq 1).
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 10-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2986 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | No |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 Skin Corr. 1B |








