A3256112
Decafluorobiphenyl , 99% , 434-90-2
CAS NO.:434-90-2
Empirical Formula: C12F10
Molecular Weight: 334.11
MDL number: MFCD00000292
EINECS: 207-107-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.00 | In Stock |
|
| 5G | RMB91.20 | In Stock |
|
| 25G | RMB372.00 | In Stock |
|
| 100G | RMB1284.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68-70 °C(lit.) |
| Boiling point: | 206 °C(lit.) |
| Density | 1,785 g/cm3 |
| refractive index | 1.3170 (estimate) |
| Flash point: | 206°C |
| storage temp. | room temp |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline Solid |
| color | White |
| Water Solubility | Insoluble in water. |
| BRN | 1916978 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C12F10/c13-3-1(4(14)8(18)11(21)7(3)17)2-5(15)9(19)12(22)10(20)6(2)16 |
| InChIKey | ONUFSRWQCKNVSL-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(c(F)c1F)-c2c(F)c(F)c(F)c(F)c2F |
| CAS DataBase Reference | 434-90-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,1'-Biphenyl, 2,2',3,3',4,4',5,5',6,6'-decafluoro-(434-90-2) |
| EPA Substance Registry System | Decafluorobiphenyl (434-90-2) |
Description and Uses
Decafluorobiphenyl is used as an intermediate in organic synthesis and in pharmaceuticals.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H336-H351-H373 |
| Precautionary statements | P261-P281-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 36/37/38-63-43-23/24/25-45-67-40 |
| Safety Statements | 22-24/25-36/37-23-53-37/39-26 |
| RIDADR | UN 3152 9/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| PackingGroup | II |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) or 1.0 kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







