A3261112
2,5-Dichloropyridine , 99% , 16110-09-1
CAS NO.：16110-09-1
Empirical Formula: C5H3Cl2N
Molecular Weight: 147.99
MDL number: MFCD00006239
EINECS: 240-278-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB40.80 | In Stock |
|
| 100G | RMB106.40 | In Stock |
|
| 500g | RMB399.20 | In Stock |
|
| 2.5kg | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59-62 °C (lit.) |
| Boiling point: | 190-191 °C |
| Density | 1.5159 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Flash point: | 112 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -2.25±0.10(Predicted) |
| form | Crystalline Solid |
| color | White to slightly yellow |
| Water Solubility | insoluble |
| BRN | 108886 |
| InChI | InChI=1S/C5H3Cl2N/c6-4-1-2-5(7)8-3-4/h1-3H |
| InChIKey | GCTFDMFLLBCLPF-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(Cl)C=C1 |
| CAS DataBase Reference | 16110-09-1(CAS DataBase Reference) |
Description and Uses
2,5-Dichloropyridine was used in the synthesis of 6-halo-pyridin-3-yl boronic acids and esters. It undergoes cross-coupling reaction with arylboronic acids in the presence of [1,4-bis-(diphenylphosphine)butane]palladium (II) dichloride as catalyst.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-37/39-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| RTECS | US8225000 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HazardClass | 6.1 |
| HS Code | 29333990 |
