A3262012
2,3-Difluoroaniline , 98% , 4519-40-8
CAS NO.：4519-40-8
Empirical Formula: C6H5F2N
Molecular Weight: 129.11
MDL number: MFCD00010298
EINECS: 224-847-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB92.00 | In Stock |
|
| 25g | RMB412.00 | In Stock |
|
| 100g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 68-69 °C |
| Density | 1.274 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 160 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.19±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 1.274 |
| color | Clear light orange |
| BRN | 2716500 |
| InChI | InChI=1S/C6H5F2N/c7-4-2-1-3-5(9)6(4)8/h1-3H,9H2 |
| InChIKey | YCCQGFYAVUTQFK-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(F)=C1F |
| CAS DataBase Reference | 4519-40-8(CAS DataBase Reference) |
Description and Uses
2,3-Difluoroaniline was used in the synthesis of ethyl 2-arylamino-4-trifluoromethylpyrimidine-5-carboxylate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-27-28-36/37/39-36 |
| RIDADR | 2941 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
