BD3200648
2,6-Difluoro-3-methylaniline , 98+% , 144851-63-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 170.9±35.0 °C(Predicted) |
| Density | 1.229±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| solubility | Soluble in organic solvents. |
| pka | 1.94±0.10(Predicted) |
| InChI | InChI=1S/C7H7F2N/c1-4-2-3-5(8)7(10)6(4)9/h2-3H,10H2,1H3 |
| InChIKey | ZMNJSSZHDRBGNN-UHFFFAOYSA-N |
| SMILES | C1(N)=C(F)C=CC(C)=C1F |
Description and Uses
2,6-Difluoro-3-methylaniline is used as a solvent is convenient as the pyridine can serve both as the solvent and the catalyst in the transformation.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332 |
| Precautionary statements | P261-P280-P301+P312a-P304+P340-P305+P351+P338-P501a |
| HazardClass | 6.1 |
| HS Code | 2921420090 |
