A3262712
2,6-Difluorophenol , 98% , 28177-48-2
CAS NO.:28177-48-2
Empirical Formula: C6H4F2O
Molecular Weight: 130.09
MDL number: MFCD00002158
EINECS: 248-884-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB73.60 | In Stock |
|
| 25G | RMB309.60 | In Stock |
|
| 100G | RMB1140.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-41 °C (lit.) |
| Boiling point: | 59-61 °C/17 mmHg (lit.) |
| Density | 1,27 g/cm3 |
| Flash point: | 138 °F |
| storage temp. | 2-8°C |
| solubility | ethanol: soluble50mg/mL, clear, colorless to light yellow |
| form | Crystalline Low Melting Solid |
| pka | 7.45±0.10(Predicted) |
| color | Colorless |
| Water Solubility | Slightly soluble in water. Soluble in ethanol. |
| BRN | 2043613 |
| Henry's Law Constant | 7.0×10-1 mol/(m3Pa) at 25℃, Hilal et al. (2008) |
| InChI | InChI=1S/C6H4F2O/c7-4-2-1-3-5(8)6(4)9/h1-3,9H |
| InChIKey | CKKOVFGIBXCEIJ-UHFFFAOYSA-N |
| SMILES | C1(O)=C(F)C=CC=C1F |
| CAS DataBase Reference | 28177-48-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6-Difluorophenol(28177-48-2) |
Description and Uses
2,6-Difluorophenol undergoes oxidative polymerization in the presence of the Fe-N,N-bis(salicylidene)ethylenediamine (salen) complex (catalyst) and hydrogen peroxide (oxidizing agent) to give poly(2,6-difluoro-1,4-phenylene oxide). It is also used as pharmaceutical intermediates.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H228-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,Xi,Xn |
| Risk Statements | 11-36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| HazardClass | 4.1 |
| PackingGroup | II |
| HS Code | 29081000 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 1.0 Kg (2.2 lbs) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








