A3264212
3,4-Difluorophenol , >98.0%(GC) , 2713-33-9
CAS NO.：2713-33-9
Empirical Formula: C6H4F2O
Molecular Weight: 130.09
MDL number: MFCD00010315
EINECS: 424-300-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.80 | In Stock |
|
| 25G | RMB94.40 | In Stock |
|
| 100G | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-38 °C (lit.) |
| Boiling point: | 85 °C/20 mmHg (lit.) |
| Density | 1.2483 (estimate) |
| Flash point: | 136 °F |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 8.98±0.18(Predicted) |
| form | low melting fused solid |
| color | off white |
| BRN | 2081085 |
| InChI | InChI=1S/C6H4F2O/c7-5-2-1-4(9)3-6(5)8/h1-3,9H |
| InChIKey | BNPWVUJOPCGHIK-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(F)C(F)=C1 |
| CAS DataBase Reference | 2713-33-9(CAS DataBase Reference) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) |    GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H228-H302+H312-H314 |
| Precautionary statements | P210-P260-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xi,F,C,Xn |
| Risk Statements | 36/37/38-34-20/21/22-11-21/22 |
| Safety Statements | 26-36-45-36/37/39-16 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 4.1 |
| PackingGroup | II |
| HS Code | 29081000 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
