A3265512
3,5-Difluorophenylacetic acid , 99% , 105184-38-1
CAS NO.：105184-38-1
Empirical Formula: C8H6F2O2
Molecular Weight: 172.13
MDL number: MFCD00010316
EINECS: 626-119-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.80 | In Stock |
|
| 5G | RMB88.80 | In Stock |
|
| 25G | RMB425.60 | In Stock |
|
| 100G | RMB1200.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68-70 °C (lit.) |
| Boiling point: | 219°C (rough estimate) |
| Density | 1.3010 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.90±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 3605064 |
| InChI | InChI=1S/C8H6F2O2/c9-6-1-5(3-8(11)12)2-7(10)4-6/h1-2,4H,3H2,(H,11,12) |
| InChIKey | IGGNSAVLXJKCNH-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC(F)=CC(F)=C1 |
| CAS DataBase Reference | 105184-38-1(CAS DataBase Reference) |
Description and Uses
3,5-Difluorophenylacetic acid has been used in the synthesis of:
- N-[N-(3,5-difluorophenylacetyl)-L-alanyl]-L-phenylglycine tert-butyl ester
- N-acylalanine
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37/39-22-22/26/36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
