A3265812
2,3-Difluorophenylacetic acid , 98% , 145689-41-4
CAS NO.：145689-41-4
Empirical Formula: C8H6F2O2
Molecular Weight: 172.13
MDL number: MFCD00040968
EINECS: 642-544-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB84.00 | In Stock |
|
| 25G | RMB331.20 | In Stock |
|
| 100G | RMB923.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-119 °C (lit.) |
| Boiling point: | 258.1±25.0 °C(Predicted) |
| Density | 1.373±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.81±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to off-white |
| InChI | InChI=1S/C8H6F2O2/c9-6-3-1-2-5(8(6)10)4-7(11)12/h1-3H,4H2,(H,11,12) |
| InChIKey | UXSQXUSJGPVOKT-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC(F)=C1F |
| CAS DataBase Reference | 145689-41-4(CAS DataBase Reference) |
Description and Uses
2,3-Difluorophenylacetic acid may be used in chemical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
