A3267512
(R)-3,3'-Dibromo-1,1'-bi-2-naphthol , 97% , 111795-43-8
CAS NO.：111795-43-8
Empirical Formula: C20H12Br2O2
Molecular Weight: 444.12
MDL number: MFCD03093629
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB462.40 | In Stock |
|
| 1G | RMB1004.80 | In Stock |
|
| 5G | RMB3677.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 256-260 °C |
| alpha | +43° (c 0.22, CHCl3) |
| Boiling point: | 469.9±40.0 °C(Predicted) |
| Density | 1.761±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | within almost transparency in Methanol |
| pka | 6.43±0.50(Predicted) |
| form | Powder |
| color | White to pale yellow-beige |
| InChI | 1S/C20H12Br2O2/c21-15-9-11-5-1-3-7-13(11)17(19(15)23)18-14-8-4-2-6-12(14)10-16(22)20(18)24/h1-10,23-24H |
| InChIKey | BRTBEAXHUYEXSY-UHFFFAOYSA-N |
| SMILES | Brc1cc2c(c(c1O)c3c4c(cc(c3O)Br)cccc4)cccc2 |
Description and Uses
(R)-(+)-3,3′-Dibromo-1,1′-bi-2-naphthol reacts with zirconium(IV) tert-butoxide to form a chiral zirconium complex, which can efficiently catalyze:
- anti-selective catalytic asymmetric aldol reactions of silyl enol ethers with aldehydes
- asymmetric intramolecular [3+2] cycloaddition of hydrazone/olefins
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-37/39 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
