A3277212
Dodecaethylene glycol , 95% , 6790-09-6
Synonym(s):
PED-diol (n=12)
CAS NO.:6790-09-6
Empirical Formula: C24H50O13
Molecular Weight: 546.65
MDL number: MFCD06201001
EINECS: 229-859-1
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB105.60 | In Stock |
|
| 250mg | RMB276.00 | In Stock |
|
| 1G | RMB722.40 | In Stock |
|
| 5G | RMB2832.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38 °C |
| Boiling point: | 325 °C / 5mmHg |
| Density | 1.116±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| form | wax |
| pka | 14.06±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C24H50O13/c25-1-3-27-5-7-29-9-11-31-13-15-33-17-19-35-21-23-37-24-22-36-20-18-34-16-14-32-12-10-30-8-6-28-4-2-26/h25-26H,1-24H2 |
| InChIKey | WRZXKWFJEFFURH-UHFFFAOYSA-N |
| SMILES | C(O)COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO |
| CAS DataBase Reference | 6790-09-6 |
| EPA Substance Registry System | Dodecaethylene glycol (6790-09-6) |
Description and Uses
PEG13 is a polymer consisting of ethylene glycol subunits with two terminal hydroxyl groups. The hydroxyl groups can undergo reactions to further derivatize the compound. The hydrophilic properties of the PEG linker increases the water solubility properties of attached compounds in aqueous media.
Dodecaethylene glycol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| WGK Germany | 3 |
| HS Code | 2905.39.9000 |






