A3280612
2,5-Dimethoxybenzenesulfonyl chloride , 98% , 1483-28-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB54.40 | In Stock |
|
| 5G | RMB183.20 | In Stock |
|
| 25G | RMB838.40 | In Stock |
|
| 100G | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-116 °C (lit.) |
| Boiling point: | 359.7±32.0 °C(Predicted) |
| Density | 1.359±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C |
| form | solid |
| Appearance | Light yellow to yellow Solid |
| Sensitive | Moisture Sensitive |
| BRN | 2648547 |
| InChI | 1S/C8H9ClO4S/c1-12-6-3-4-7(13-2)8(5-6)14(9,10)11/h3-5H,1-2H3 |
| InChIKey | SHELADVIRCCTFN-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 1483-28-9(CAS DataBase Reference) |
Description and Uses
2,5-Dimethoxybenzenesulfonyl chloride can be prepared from 2,5-dimethoxybenzenesulfonic acid.1 It can also be obtained from the reaction between chlorosulfonic acid and 1,4-dimethoxybenzene.2
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H318-H314 |
| Precautionary statements | P280-P305+P351+P338-P310-P260h-P301+P330+P331-P303+P361+P353-P405-P501a |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Harmful/Moisture Sensitive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29093090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
