A3281612
Diethyl benzylmalonate , 98% , 607-81-8
CAS NO.:607-81-8
Empirical Formula: C14H18O4
Molecular Weight: 250.29
MDL number: MFCD00009166
EINECS: 210-142-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB52.00 | In Stock |
|
| 100G | RMB164.00 | In Stock |
|
| 500G | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 162-163 °C/10 mmHg (lit.) |
| Density | 1.064 g/mL at 25 °C (lit.) |
| vapor pressure | 0.26Pa at 25℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| pka | 12.56±0.46(Predicted) |
| form | Colourless Liquid |
| color | Colorless to Almost colorless |
| Water Solubility | immiscible |
| BRN | 615793 |
| InChI | 1S/C14H18O4/c1-3-17-13(15)12(14(16)18-4-2)10-11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3 |
| InChIKey | ICZLTZWATFXDLP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccccc1)C(=O)OCC |
| LogP | 2.76 |
| CAS DataBase Reference | 607-81-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Propanedioic acid, (phenylmethyl)-, diethyl ester(607-81-8) |
| EPA Substance Registry System | Propanedioic acid, 2-(phenylmethyl)-, 1,3-diethyl ester (607-81-8) |
Description and Uses
Diethyl benzylmalonate was used in the synthesis of macrocyclic ligands and determination of stability constants of their Cu(II), Ni(II) and Co(II) complexes. It was used as starting reagent for the synthesis of 2-benzyl-1,3-propane diol.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H412 |
| Precautionary statements | P273-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29173980 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 |






