A3381312
diethyl isopropylmalonate , ≥98.0%(GC) , 759-36-4
CAS NO.:759-36-4
Empirical Formula: C10H18O4
Molecular Weight: 202.25
MDL number: MFCD00040491
EINECS: 212-068-0
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB43.20 | In Stock |
|
| 25ML | RMB129.60 | In Stock |
|
| 100ML | RMB332.00 | In Stock |
|
| 500ML | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 62 °C/0.35 mmHg (lit.) |
| Density | 0.981 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 198 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 13.43±0.46(Predicted) |
| color | Colourless |
| BRN | 1101711 |
| InChI | InChI=1S/C10H18O4/c1-5-13-9(11)8(7(3)4)10(12)14-6-2/h7-8H,5-6H2,1-4H3 |
| InChIKey | BYQFBFWERHXONI-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(C(C)C)C(OCC)=O |
| CAS DataBase Reference | 759-36-4(CAS DataBase Reference) |
Description and Uses
Diethyl Isopropylmalonate can be used to treat CCR2-mediated disease.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 24/25 |
| RIDADR | NA1993 |
| WGK Germany | 1 |
| HazardClass | IRRITANT |
| HS Code | 29171900 |
| Storage Class | 10 - Combustible liquids |
| Excepted Quantities | Non-Hazardous |






