A5017112
2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane , 98% , 61676-62-8
CAS NO.:61676-62-8
Empirical Formula: C9H19BO3
Molecular Weight: 186.06
MDL number: MFCD00192241
EINECS: 612-189-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB26.40 | In Stock |
|
| 25G | RMB51.20 | In Stock |
|
| 100g | RMB88.00 | In Stock |
|
| 500g | RMB400.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 73 °C15 mm Hg(lit.) |
| Density | 0.912 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 109 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| Specific Gravity | 0.912 |
| color | Colorless |
| Water Solubility | Soluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 1906370 |
| InChI | InChI=1S/C9H19BO3/c1-7(2)11-10-12-8(3,4)9(5,6)13-10/h7H,1-6H3 |
| InChIKey | MRWWWZLJWNIEEJ-UHFFFAOYSA-N |
| SMILES | O1C(C)(C)C(C)(C)OB1OC(C)C |
| CAS DataBase Reference | 61676-62-8(CAS DataBase Reference) |
Description and Uses
2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane can be used as a reagent to borylate arenes and to prepare fluorenylborolane.
It can also be used in the synthesis of following intermediates for generating conjugated copolymers:
- 9,9-Dioctyl-2,7-bis(4,4,5,5-tetramethyl1,3,2-dioxaborolane-2-yl)dibenzosilole.
- 3,9-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-di(1-decylundecyl)indolo[3,2-b]carbazole.
- 2,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9-dioctylfluorene.
- 2,7-Bis(4′,4′,5′,5′-tetramethyl-1′,3′,2′-dioxaborolan-2′-yl)-N-9′′-heptadecanylcarbazole.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29209090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







