A5093112
Isopropylamine Hydrochloride , 98% , 15572-56-2
CAS NO.:15572-56-2
Empirical Formula: C3H10ClN
Molecular Weight: 95.57
MDL number: MFCD00050705
EINECS: 239-629-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB102.40 | In Stock |
|
| 100G | RMB356.00 | In Stock |
|
| 500G | RMB972.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Methanol (Slightly), Water |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C3H9N.ClH/c1-3(2)4;/h3H,4H2,1-2H3;1H |
| InChIKey | ISYORFGKSZLPNW-UHFFFAOYSA-N |
| SMILES | C(N)(C)C.Cl |
| CAS DataBase Reference | 15572-56-2(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propanamine, hydrochloride (15572-56-2) |
Description and Uses
Isopropylamine Hydrochloride is an intermediate in the synthesis of 1-Cyano-3-isopropylguanidine (C955800).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 26-36/37/39-39 |
| RTECS | NT9530000 |
| TSCA | TSCA listed |
| HS Code | 2921199990 |







