BD9174331
trans-2-Aminocyclohexanol hydrochloride , 98% , 5456-63-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB65.60 | In Stock |
|
| 5g | RMB231.20 | In Stock |
|
| 10g | RMB448.00 | In Stock |
|
| 25g | RMB1010.40 | In Stock |
|
| 100g | RMB3813.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172-175 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble25mg/mL, clear, colorless (1N acetic acid in methanol) |
| form | Crystalline Powder |
| color | White or beige to light brown |
| Water Solubility | soluble 25mg/mL, clear, colorless (1N acetic acid in methanol) |
| Sensitive | Hygroscopic |
| InChI | InChI=1/C6H13NO.ClH/c7-5-3-1-2-4-6(5)8;/h5-6,8H,1-4,7H2;1H/t5-,6-;/s3 |
| InChIKey | LKKCSUHCVGCGFA-ATPDZTHWNA-N |
| SMILES | [C@H]1(N)CCCC[C@@H]1O.Cl |&1:0,6,r| |
| CAS DataBase Reference | 5456-63-3(CAS DataBase Reference) |
Description and Uses
NSC 21550 is used in preparation of Benzoxazinone derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| HS Code | 29221985 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







