A3281912
1,3,-Dichloro-4,6-dinitrobenzene , 98% , 3698-83-7
CAS NO.:3698-83-7
Empirical Formula: C6H2Cl2N2O4
Molecular Weight: 237
MDL number: MFCD00024186
EINECS: 223-027-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB119.20 | In Stock |
|
| 25G | RMB553.60 | In Stock |
|
| 100g | RMB1664.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-104 °C(lit.) |
| Boiling point: | 337.6±37.0 °C(Predicted) |
| Density | 1.729±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| Water Solubility | Insoluble in water. |
| BRN | 1685438 |
| InChI | 1S/C6H2Cl2N2O4/c7-3-1-4(8)6(10(13)14)2-5(3)9(11)12/h1-2H |
| InChIKey | ZPXDNSYFDIHPOJ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(c(Cl)cc1Cl)[N+]([O-])=O |
| CAS DataBase Reference | 3698-83-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3-Dichloro-4,6-dinitrobenzene(3698-83-7) |
| EPA Substance Registry System | Benzene, 1,5-dichloro-2,4-dinitro- (3698-83-7) |
Description and Uses
1,5-Dichloro-2,4-dinitrobenzene is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS09,GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H331-H335-H400-H410 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a-P273-P391-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N,Xi |
| Risk Statements | 50 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





