A3282612
2,3-Dimethyl-4-nitroanisole , 98% , 81029-03-0
CAS NO.：81029-03-0
Empirical Formula: C9H11NO3
Molecular Weight: 181.19
MDL number: MFCD00007163
EINECS: 279-674-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB86.40 | In Stock |
|
| 5g | RMB284.80 | In Stock |
|
| 10G | RMB485.60 | In Stock |
|
| 25g | RMB959.20 | In Stock |
|
| 100g | RMB3096.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-73 °C(lit.) |
| Boiling point: | 314.29°C (rough estimate) |
| Density | 1.2375 (rough estimate) |
| refractive index | 1.5270 (estimate) |
| storage temp. | Store at room temperature |
| Appearance | Light yellow to yellow Powder |
| InChI | 1S/C9H11NO3/c1-6-7(2)9(13-3)5-4-8(6)10(11)12/h4-5H,1-3H3 |
| InChIKey | DUBFMQLUMHKYOX-UHFFFAOYSA-N |
| SMILES | COc1ccc(c(C)c1C)[N+]([O-])=O |
| CAS DataBase Reference | 81029-03-0(CAS DataBase Reference) |
Description and Uses
2,3-Dimethyl-4-nitroanisole was used:
- as starting material in the synthesis of conformationally restricted derivatives of lavendustin A
- in the synthesis of 1,4-piperazine-2,5-diones
Safety
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29093090 |
| Storage Class | 13 - Non Combustible Solids |
