A3283912
α,α′-Dibromo-o-xylene , 97% , 91-13-4
Synonym(s):
o-Xylylene dibromide;1,2-Bis(bromomethyl)benzene
CAS NO.:91-13-4
Empirical Formula: C8H8Br2
Molecular Weight: 263.96
MDL number: MFCD00000175
EINECS: 202-042-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB367.20 | In Stock |
|
| 500g | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 91-94 °C(lit.) |
| Boiling point: | 140 °C / 20mmHg |
| Density | 1.96 g/mL at 25 °C(lit.) |
| refractive index | 1.6113 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | sol ethanol, ether, chloroform; slightly sol petroleum ether. |
| form | Crystals or Crystalline Powder |
| color | White to light cream |
| Water Solubility | soluble, hydrolyses |
| BRN | 637159 |
| InChI | InChI=1S/C8H8Br2/c9-5-7-3-1-2-4-8(7)6-10/h1-4H,5-6H2 |
| InChIKey | KGKAYWMGPDWLQZ-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=CC=C1CBr |
| CAS DataBase Reference | 91-13-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,2-bis(bromomethyl)-(91-13-4) |
| EPA Substance Registry System | Benzene, 1,2-bis(bromomethyl)- (91-13-4) |
Description and Uses
1,2-Bis(bromomethyl)benzene is used in the synthesis of isothioureas involved in the inhibition of human nitric oxide synthases. Also used in the synthesis of tridentate carbene ligands.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3448 6.1/PG 2 |
| WGK Germany | 2 |
| F | 8-19-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29036990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |





