A3284712
3,4-Difluorobenzonitrile , 98% , 64248-62-0
CAS NO.：64248-62-0
Empirical Formula: C7H3F2N
Molecular Weight: 139.1
MDL number: MFCD00011666
EINECS: 264-751-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB60.80 | In Stock |
|
| 100G | RMB191.20 | In Stock |
|
| 500g | RMB711.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-54 °C (lit.) |
| Boiling point: | 180 °C |
| Density | 1.2490 (estimate) |
| Flash point: | 157 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to lump |
| color | White to Light yellow |
| BRN | 2082224 |
| InChI | InChI=1S/C7H3F2N/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
| InChIKey | BTBFCBQZFMQBNT-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(F)C(F)=C1 |
| CAS DataBase Reference | 64248-62-0(CAS DataBase Reference) |
Description and Uses
3,4-Difluorobenzonitrile has been used in the preparation of:
- fluorophenoxy herbicides
- fluorine substituted benzyl amides
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37-36/37/39 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
