A3285112
3,5-Dichloro-4-fluorobenzotrifluoride , 98% , 77227-81-7
CAS NO.：77227-81-7
Empirical Formula: C7H2Cl2F4
Molecular Weight: 232.99
MDL number: MFCD00068183
EINECS: 620-878-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB223.20 | In Stock |
|
| 5G | RMB799.20 | In Stock |
|
| 25G | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 166-168 °C (lit.) |
| Density | 1.555 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 164 °F |
| storage temp. | Storage temp. 2-8°C |
| form | liquid |
| color | Clear |
| BRN | 6199573 |
| InChI | 1S/C7H2Cl2F4/c8-4-1-3(7(11,12)13)2-5(9)6(4)10/h1-2H |
| InChIKey | BWQFQKZDLBJZAW-UHFFFAOYSA-N |
| SMILES | Fc1c(Cl)cc(cc1Cl)C(F)(F)F |
| CAS DataBase Reference | 77227-81-7(CAS DataBase Reference) |
Description and Uses
3,5-Dichloro-4-fluorobenzotrifluoride may be used for the synthesis of 3-[4-[1-(2,6-dichloro-3-iodo-4-trifluoromethylphenyl)-5-iodopyrazolo]]-3-(trifluoromethyl)diazirine.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H318 |
| Precautionary statements | P280-P301+P310+P330-P305+P351+P338+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-41 |
| Safety Statements | 26-36 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |
