A3285312
2,3-Diaminotoluene , 98% , 2687-25-4
Synonym(s):
3-Methyl-o-phenylenediamine
CAS NO.:2687-25-4
Empirical Formula: C7H10N2
Molecular Weight: 122.17
MDL number: MFCD00011589
EINECS: 220-248-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB123.20 | In Stock |
|
| 100G | RMB439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59-65 °C (lit.) |
| Boiling point: | 225°C |
| Density | 1.0343 (rough estimate) |
| refractive index | 1.5103 (estimate) |
| Flash point: | 225°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Dichloromethane |
| form | Powder or Crystals |
| pka | 4.28±0.10(Predicted) |
| color | Brown to dark brown |
| BRN | 907184 |
| InChI | InChI=1S/C7H10N2/c1-5-3-2-4-6(8)7(5)9/h2-4H,8-9H2,1H3 |
| InChIKey | AXNUJYHFQHQZBE-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(C)=C1N |
| CAS DataBase Reference | 2687-25-4(CAS DataBase Reference) |
| EPA Substance Registry System | 1,2-Benzenediamine, 3-methyl- (2687-25-4) |
Description and Uses
Inducer of CYP1A activity, and possible mutagenic carcinogen.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | XS9550000 |
| Hazard Note | Harmful/Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 2687-25-4(Hazardous Substances Data) |
| Toxicity | mouse,LD50,intraperitoneal,286mg/kg (286mg/kg),Genetica Polonica. Vol. 26, Pg. 109, 1985. |






