A3285912
2,6-Difluorobenzyl chloride , ≥98% , 697-73-4
CAS NO.:697-73-4
Empirical Formula: C7H5ClF2
Molecular Weight: 162.56
MDL number: MFCD00191346
EINECS: 615-010-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB42.40 | In Stock |
|
| 5G | RMB90.40 | In Stock |
|
| 25G | RMB311.20 | In Stock |
|
| 100G | RMB916.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-38 °C(lit.) |
| Boiling point: | 172-173°C 640mm |
| Density | 1.2730 (estimate) |
| Flash point: | 151 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White Waxy |
| Water Solubility | Soluble in acetone, DMSO and DMF. Insoluble in water. |
| Sensitive | Lachrymatory |
| BRN | 243793 |
| InChI | InChI=1S/C7H5ClF2/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2 |
| InChIKey | MJXRENZUAQXZGJ-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(F)=C1CCl |
| CAS DataBase Reference | 697-73-4(CAS DataBase Reference) |
Description and Uses
2,6-Difluorobenzyl chloride is used as rufinamide intermediate. It is an important raw material and intermediate used in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Statements | 34-20/22 |
| Safety Statements | 26-36/37/39-45-60-20 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






