A3287812
2'-Deoxy-5-methylcytidine , 99% , 838-07-3
CAS NO.:838-07-3
Empirical Formula: C10H15N3O4
Molecular Weight: 241.24
MDL number: MFCD00006549
EINECS: 212-655-1
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB44.80 | In Stock |
|
| 250MG | RMB53.60 | In Stock |
|
| 500MG | RMB95.20 | In Stock |
|
| 1G | RMB150.40 | In Stock |
|
| 5G | RMB645.60 | In Stock |
|
| 25g | RMB2790.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 217-219 °C(lit.) |
| Boiling point: | 492.8±55.0 °C(Predicted) |
| Density | 1?+-.0.1 g/cm3(Predicted) |
| refractive index | 44 ° (C=1.4, H2O) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated), Water (Slightly) |
| form | Powder |
| pka | pK1:4.33 (25°C) |
| color | White to Off-white |
| optical activity | 41.1°(C=0.009986 g/ml H2O) |
| Water Solubility | Soluble in water. |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C10H15N3O4/c1-5-3-13(10(16)12-9(5)11)8-2-6(15)7(4-14)17-8/h3,6-8,14-15H,2,4H2,1H3,(H2,11,12,16)/t6-,7+,8+/m0/s1 |
| InChIKey | LUCHPKXVUGJYGU-XLPZGREQSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C=C(C)C(N)=NC2=O)C[C@@H]1O |
| CAS DataBase Reference | 838-07-3(CAS DataBase Reference) |
Description and Uses
5-Methyl-2'-deoxycytidine is a nucleoside analogue that inhibits the synthesis of DNA. 5-Methyl-2'-deoxycytidine prevents methylation of guanine, which disrupts the binding of guanine nucleotide-binding proteins to the dna template and prevents polymerase chain reactions. 2'-Deoxy-5-methylcytidine is also a methyltransferase inhibitor, which means it blocks the enzyme responsible for adding methyl groups to cytosine molecules.
5-Methyl-2'-deoxycytidine in single-stranded DNA can act in cis to signal de novo DNA methylation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| RTECS | HA3860000 |
| HS Code | 29389090 |






