A3290312
4,4'-Diacetylbiphenyl , >99.0%(GC) , 787-69-9
CAS NO.:787-69-9
Empirical Formula: C16H14O2
Molecular Weight: 238.28
MDL number: MFCD00017248
EINECS: 625-368-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB72.80 | In Stock |
|
| 100G | RMB221.60 | In Stock |
|
| 500G | RMB833.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-195 °C(lit.) |
| Boiling point: | 340.88°C (rough estimate) |
| Density | 1.0981 (rough estimate) |
| refractive index | 1.6290 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform[soluble in] |
| solubility | soluble in Chloroform |
| form | Crystalline Powder |
| color | Colorless to light tan |
| InChI | InChI=1S/C16H14O2/c1-11(17)13-3-7-15(8-4-13)16-9-5-14(6-10-16)12(2)18/h3-10H,1-2H3 |
| InChIKey | YSTSBXDVNKYPTR-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(C(=O)C)C=C2)=CC=C(C(=O)C)C=C1 |
| CAS DataBase Reference | 787-69-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 4,4'-Diacetyl biphenyl(787-69-9) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) | ![]() ![]() GHS09,GHS07 |
| Signal word | Warning |
| Hazard statements | H410-H315-H319-H335-H400 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P391-P501-P273 |
| Hazard Codes | N,Xi,Xn |
| Risk Statements | 50/53-36/37/38-20/21/22 |
| Safety Statements | 60-61-36/37/39-26-37/39-36 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29173990 |





