A3292212
Dimethyl 5-hydroxyisophthalate , 98% , 13036-02-7
Synonym(s):
Dimethyl 5-hydroxybenzene-1,3-dicarboxylate
CAS NO.：13036-02-7
Empirical Formula: C10H10O5
Molecular Weight: 210.18
MDL number: MFCD00134367
EINECS: 235-899-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 10G | RMB71.20 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 50G | RMB164.00 | In Stock |
|
| 100G | RMB351.20 | In Stock |
|
| 250G | RMB647.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-164 °C (lit.) |
| Boiling point: | 360.6±22.0 °C(Predicted) |
| Density | 1.284±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Powder and/or Lumps |
| pka | 8.33±0.10(Predicted) |
| color | White to light beige |
| Water Solubility | Soluble in water. |
| BRN | 2650120 |
| InChI | InChI=1S/C10H10O5/c1-14-9(12)6-3-7(10(13)15-2)5-8(11)4-6/h3-5,11H,1-2H3 |
| InChIKey | DOSDTCPDBPRFHQ-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=CC(O)=CC(C(OC)=O)=C1 |
| LogP | 2.570 (est) |
| CAS DataBase Reference | 13036-02-7(CAS DataBase Reference) |
| EPA Substance Registry System | Dimethyl 5-hydroxyisophthalate (13036-02-7) |
Description and Uses
Dimethyl 5-Hydroxyisophthalate is a useful synthetic intermediate in the synthesis of N,N?-Bis(2,3-dihydroxypropyl)-5-[(N-(2-hydroxyethyl)carbamoyl)methoxy]-2,4,6-triiodoisophthalamide (B426310); a compound related to Ioversol( I737000) which is a nonionic, low osmolality, radiographic contrast agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29182900 |
