A3293312
Diallylmethylamine , 97% , 2424-01-3
CAS NO.:2424-01-3
Empirical Formula: C7H13N
Molecular Weight: 111.18
MDL number: MFCD00039824
EINECS: 219-354-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB60.80 | In Stock |
|
| 25G | RMB89.60 | In Stock |
|
| 100G | RMB239.20 | In Stock |
|
| 500G | RMB724.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112 °C |
| Boiling point: | 111 °C (lit.) |
| Density | 0.789 g/mL at 25 °C (lit.) |
| vapor pressure | 25.6hPa at 20℃ |
| refractive index | n |
| Flash point: | 45 °F |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| form | Liquid |
| pka | 8.01±0.50(Predicted) |
| Specific Gravity | 0.769 |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C7H13N/c1-4-6-8(3)7-5-2/h4-5H,1-2,6-7H2,3H3 |
| InChIKey | WGESLFUSXZBFQF-UHFFFAOYSA-N |
| SMILES | C(N(C)CC=C)C=C |
| CAS DataBase Reference | 2424-01-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyldiallylamine(2424-01-3) |
| EPA Substance Registry System | 2-Propen-1-amine, N-methyl-N-2-propenyl- (2424-01-3) |
Description and Uses
Diallylmethylamine may be used in the synthesis of the following:
- diallyldimethylammonium iodide
- diallylethylmethylammonium bromide
- diallylbenzylmethylammonium chloride
- alkyl substituted diallylmethyl quaternary ammonium salt monomers
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H225-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,C |
| Risk Statements | 11-34 |
| Safety Statements | 16-26-36/37/39-45 |
| RIDADR | UN 2733 3/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 3, 8 |
| HS Code | 2921199990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








