A3294112
2,4-Dichloro-6,7-dimethoxyquinazoline , 98% , 27631-29-4
Synonym(s):
2,4-Dichloro-6,7-dimethoxyquinazoline
CAS NO.：27631-29-4
Empirical Formula: C10H8Cl2N2O2
Molecular Weight: 259.09
MDL number: MFCD00051733
EINECS: 608-117-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB159.20 | In Stock |
|
| 25G | RMB639.20 | In Stock |
|
| 100g | RMB2343.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-178 °C (lit.) |
| Boiling point: | 340.5±42.0 °C(Predicted) |
| Density | 1.5369 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | -0.49±0.30(Predicted) |
| form | Crystalline Powder |
| color | Pale yellow to beige |
| Water Solubility | Insoluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 190331 |
| InChI | 1S/C10H8Cl2N2O2/c1-15-7-3-5-6(4-8(7)16-2)13-10(12)14-9(5)11/h3-4H,1-2H3 |
| InChIKey | DGHKCBSVAZXEPP-UHFFFAOYSA-N |
| SMILES | COc1cc2nc(Cl)nc(Cl)c2cc1OC |
| CAS DataBase Reference | 27631-29-4(CAS DataBase Reference) |
Description and Uses
An intermediate in the preparation of potential inhibitors of epidermal growth factor receptor kinases. An intermediate in the preparation of Terazosin (T105000).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 3 |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
