A3294212
4,7-Dichloro-1,10-phenanthroline , 97% , 5394-23-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB142.40 | In Stock |
|
| 1G | RMB540.00 | In Stock |
|
| 5g | RMB1892.80 | In Stock |
|
| 10g | RMB2868.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 243-247 °C |
| Boiling point: | 395.9±37.0 °C(Predicted) |
| Density | 1.482±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| pka | 3.29±0.10(Predicted) |
| color | white to tan |
| InChI | InChI=1S/C12H6Cl2N2/c13-9-3-5-15-11-7(9)1-2-8-10(14)4-6-16-12(8)11/h1-6H |
| InChIKey | GIEQBYJCGYHHSU-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C3C=2N=CC=C3Cl)C(Cl)=CC=1 |
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P261-P264-P280-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 6.1 |
| HS Code | 29339900 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
