A3295812
2,3-Diamino-5-bromopyridine , >98.0%(GC) , 38875-53-5
CAS NO.:38875-53-5
Empirical Formula: C5H6BrN3
Molecular Weight: 188.03
MDL number: MFCD00460094
EINECS: 254-172-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB53.60 | In Stock |
|
| 25G | RMB224.80 | In Stock |
|
| 100G | RMB849.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155 °C (dec.) (lit.) |
| Boiling point: | 180 °C(Press: 0.005-0.01 Torr) |
| Density | 1.6770 (rough estimate) |
| refractive index | 1.6400 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 4.53±0.49(Predicted) |
| form | Powder or Needles |
| color | Light yellow to purple or light brown |
| Water Solubility | soluble in hot water |
| BRN | 119436 |
| InChI | InChI=1S/C5H6BrN3/c6-3-1-4(7)5(8)9-2-3/h1-2H,7H2,(H2,8,9) |
| InChIKey | YRGMYJUKFJPNPD-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(Br)C=C1N |
| CAS DataBase Reference | 38875-53-5(CAS DataBase Reference) |
Description and Uses
2,3-Diamino-5-bromopyridine may be used in the preparation of the following heterocyclic compounds:
- 6-bromoimidazo-[b]pyridine
- 11-bromopyrido[2′,3′:5,6]pyrazino[2,3-f][1,10]phenanthroline
- 6-bromo-3-(tetrahydro-2H-pyran-2-yl)-3H-imidazo[4,5-b]pyridine
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 26-36-37/39-45-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT-HARMFUL |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







