A3296812
2,3-Difluorophenol , ≥98.0% , 6418-38-8
CAS NO.：6418-38-8
Empirical Formula: C6H4F2O
Molecular Weight: 130.09
MDL number: MFCD00010262
EINECS: 264-750-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB33.60 | In Stock |
|
| 25G | RMB109.60 | In Stock |
|
| 100G | RMB374.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 39-42 °C (lit.) |
| Boiling point: | 54 °C/25 mmHg (lit.) |
| Density | 1.2483 (estimate) |
| Flash point: | 134 °F |
| storage temp. | Inert atmosphere,2-8°C |
| pka | 7.71±0.10(Predicted) |
| form | powder to lump to clear liquid |
| color | White or Colorless to Almost white or Almost colorless |
| BRN | 2082265 |
| InChI | InChI=1S/C6H4F2O/c7-4-2-1-3-5(9)6(4)8/h1-3,9H |
| InChIKey | RPEPGIOVXBBUMJ-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC(F)=C1F |
| CAS DataBase Reference | 6418-38-8(CAS DataBase Reference) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H302-H315-H319-H335 |
| Precautionary statements | P210-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | F,Xn,Xi,C |
| Risk Statements | 11-22-36/37/38-34-20/21/22 |
| Safety Statements | 26-45-36/37/39-16 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29081000 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
