A3298012
3,3′-Dibromo-2,2′-bithiophene , 98% , 51751-44-1
CAS NO.:51751-44-1
Empirical Formula: C8H4Br2S2
Molecular Weight: 324.06
MDL number: MFCD00114806
EINECS: 663-413-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB57.60 | In Stock |
|
| 5G | RMB219.20 | In Stock |
|
| 25G | RMB936.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 103°C |
| Boiling point: | 318.6±37.0 °C(Predicted) |
| Density | 1.951±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C8H4Br2S2/c9-5-1-3-11-7(5)8-6(10)2-4-12-8/h1-4H |
| InChIKey | KBRZCEVRNLKHAZ-UHFFFAOYSA-N |
| SMILES | C1(C2SC=CC=2Br)SC=CC=1Br |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H318 |
| Precautionary statements | P280-P301+P310+P330-P305+P351+P338+P310 |
| Hazard Codes | T |
| Risk Statements | 25-41 |
| Safety Statements | 26-39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |




![4-(4-Bromophenyl)dibenzo[b,d]thiophene](https://img.chemicalbook.com/CAS/GIF/530402-77-8.gif)

![2,6-Dibromodithieno[3,2-b:2’,3’-d]thiophene](https://img.chemicalbook.com/CAS/GIF/67061-69-2.gif)
