A3300112
2,4-Dibromobenzoic acid , 98% , 611-00-7
CAS NO.：611-00-7
Empirical Formula: C7H4Br2O2
Molecular Weight: 279.91
MDL number: MFCD00234253
EINECS: 210-245-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB52.80 | In Stock |
|
| 5G | RMB199.20 | In Stock |
|
| 25g | RMB536.80 | In Stock |
|
| 100g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171.0 to 175.0 °C |
| Boiling point: | 336.6±32.0 °C(Predicted) |
| Density | 1.9661 (rough estimate) |
| refractive index | 1.4970 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.62±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H4Br2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11) |
| InChIKey | NAGGYODWMPFKJQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Br)C=C1Br |
Description and Uses
2,4-Dibromobenzoic acid is a benzoic acid compound with a reactive group bromine atom for copper-catalysed coupling reactions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| HS Code | 29163990 |
