A3302112
2-Deoxy-2,2-difluoro-D-erythro-pentonic Acid γ-Lactone 3,5-Dibenzoate , 98% , 122111-01-7
CAS NO.:122111-01-7
Empirical Formula: C19H14F2O6
Molecular Weight: 376.31
MDL number: MFCD00209570
EINECS: 601-822-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB65.60 | In Stock |
|
| 25G | RMB205.60 | In Stock |
|
| 100g | RMB570.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-119 °C(lit.) |
| Boiling point: | 437.2±45.0 °C(Predicted) |
| Density | 1.41±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1/C19H14F2O6/c20-19(21)15(27-17(23)13-9-5-2-6-10-13)14(26-18(19)24)11-25-16(22)12-7-3-1-4-8-12/h1-10,14-15H,11H2/t14-,15+/s3 |
| InChIKey | SHHNEUNVMZNOID-LSDHHAIUSA-N |
| SMILES | [C@@H]1(COC(=O)C2=CC=CC=C2)OC(=O)C(F)(F)[C@@H]1OC(=O)C1C=CC=CC=1 |&1:0,17,r| |
| CAS DataBase Reference | 122111-01-7(CAS DataBase Reference) |
Description and Uses
2-Deoxy-2,2-difluoro-D-erythro-pentofuranos-1-ulose-3,5-dibenzoate (cas# 122111-01-7) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29322090 |







